Difference between revisions of "Keratan-sulfate-NAcGlcN6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15662 == * common-name: ** (3r)-hydroxy, 4-trans-undecenoyl-coa * smiles: ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15662 ==
+
== Metabolite Keratan-sulfate-NAcGlcN6S ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy, 4-trans-undecenoyl-coa
+
** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
* smiles:
 
** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** anvriwfxmmcuph-qyzxfxbmsa-j
 
* molecular-weight:
 
** 945.764
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14791]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}}
+
{{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
{{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}}
 
{{#set: molecular-weight=945.764}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Keratan-sulfate-NAcGlcN6S

  • common-name:
    • [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.