Difference between revisions of "L-1-GLYCERO-PHOSPHORYLCHOLINE"

Revision as of 18:58, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-EPINEPHRINE ==
+== Metabolite SULFATE ==
 * common-name:
-** (r)-adrenaline
+** sulfate
 * smiles:
-** c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
+** o=s(=o)([o-])[o-]
 * inchi-key:
-** uctwmzqnuqwslp-vifpvbqesa-o
+** qaowncqodcnurd-uhfffaoysa-l
 * molecular-weight:
-** 184.214
+** 96.058
 == Reaction(s) known to consume the compound ==
-* [[RXN-10908]]
+* [[ExchangeSeed-SULFATE]]
+* [[FESO3OXI-RXN]]
+* [[SULFATE-ADENYLYLTRANS-RXN]]
+* [[TransportSeed-SULFATE]]
 == Reaction(s) known to produce the compound ==
+* [[3.1.6.12-RXN]]
+* [[3.1.6.14-RXN]]
+* [[ADENYLYLSULFATASE-RXN]]
+* [[ARYLSULFAT-RXN]]
+* [[ExchangeSeed-SULFATE]]
+* [[FESO3OXI-RXN]]
+* [[RXN-11570]]
+* [[SULFATE-ADENYLYLTRANS-RXN]]
+* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
+* [[SULFITE-OXIDASE-RXN]]
+* [[TransportSeed-SULFATE]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(r)-adrenaline}}
+{{#set: common-name=sulfate}}
-{{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}}
+{{#set: inchi-key=inchikey=qaowncqodcnurd-uhfffaoysa-l}}
-{{#set: molecular-weight=184.214}}
+{{#set: molecular-weight=96.058}}