Difference between revisions of "L-1-GLYCERO-PHOSPHORYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite L- | + | == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** sn-glycero-3-phosphocholine |
* smiles: | * smiles: | ||
| − | ** c[n+] | + | ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** suhoquvvvlnyqr-mrvpvssysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 257.223 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LYSOPHOSPHOLIPASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycero-3-phosphocholine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=257.223}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE
- common-name:
- sn-glycero-3-phosphocholine
- smiles:
- c([n+](c)(c)c)cop([o-])(=o)occ(o)co
- inchi-key:
- suhoquvvvlnyqr-mrvpvssysa-n
- molecular-weight:
- 257.223
