Difference between revisions of "L-1-GLYCERO-PHOSPHORYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] ==
+
== Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** sn-glycero-3-phosphocholine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.2.1 ec-1.2.1]
+
** c([n+](c)(c)c)cop([o-])(=o)occ(o)co
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-6082]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[B-ALANINE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[PROTON]][c]
+
** suhoquvvvlnyqr-mrvpvssysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05897]]
+
** 257.223
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ06470]]
+
* [[LYSOPHOSPHOLIPASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=sn-glycero-3-phosphocholine}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}}
−
* Gene: [[SJ11331]]
+
{{#set: molecular-weight=257.223}}
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ06456]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-3981]], β-alanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5760]], β-alanine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.2.1}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE

  • common-name:
    • sn-glycero-3-phosphocholine
  • smiles:
    • c([n+](c)(c)c)cop([o-])(=o)occ(o)co
  • inchi-key:
    • suhoquvvvlnyqr-mrvpvssysa-n
  • molecular-weight:
    • 257.223

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-1-GLYCERO-PHOSPHORYLCHOLINE&oldid=139086"