Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13152 == * transcription-direction: ** negative * right-end-position: ** 291263 * left-end-position: ** 276539 * centisome-position: ** 80.10910...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == |
| − | * | + | * common-name: |
| − | ** | + | ** sn-glycero-3-phosphoethanolamine |
| − | * | + | * smiles: |
| − | ** | + | ** c(op([o-])(occ(co)o)=o)c[n+] |
| − | * | + | * inchi-key: |
| − | ** | + | ** jznwscpgtdbmew-rxmqykedsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 215.142 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14160]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-15035]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=sn-glycero-3-phosphoethanolamine}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=215.142}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- common-name:
- sn-glycero-3-phosphoethanolamine
- smiles:
- c(op([o-])(occ(co)o)=o)c[n+]
- inchi-key:
- jznwscpgtdbmew-rxmqykedsa-n
- molecular-weight:
- 215.142
