Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite XLFG-Xyloglucans == * common-name: ** an xlfg xylogulcan == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XLFG-Xyloglucans == |
* common-name: | * common-name: | ||
| − | ** | + | ** an xlfg xylogulcan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9463]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an xlfg xylogulcan}} |
| − | |||
| − | |||
Revision as of 14:53, 5 January 2021
Contents
Metabolite XLFG-Xyloglucans
- common-name:
- an xlfg xylogulcan
