Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16890 == * transcription-direction: ** negative * right-end-position: ** 49524 * left-end-position: ** 8160 * centisome-position: ** 2.9598355...") |
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-1-LYSOPHOSPHATIDATE == |
− | * | + | * common-name: |
− | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
− | * | + | * smiles: |
− | ** | + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
− | * | + | * inchi-key: |
− | ** | + | ** wrgqswvcfniunz-gdckjwnlsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 434.509 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15043]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-15045]] |
− | * | + | * [[RXN-15068]] |
− | * | + | * [[RXN-15091]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=1-oleyl-2-lyso-phosphatidate}} | |
− | + | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=434.509}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleyl-2-lyso-phosphatidate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- molecular-weight:
- 434.509