Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Octapeptides == * common-name: ** an octapeptide == Reaction(s) known to consume the compound == == Reaction(s) known to produce the comp...") |
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-1-LYSOPHOSPHATIDATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
+ | * smiles: | ||
+ | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o | ||
+ | * inchi-key: | ||
+ | ** wrgqswvcfniunz-gdckjwnlsa-l | ||
+ | * molecular-weight: | ||
+ | ** 434.509 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15043]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15045]] |
+ | * [[RXN-15068]] | ||
+ | * [[RXN-15091]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-oleyl-2-lyso-phosphatidate}} |
+ | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} | ||
+ | {{#set: molecular-weight=434.509}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleyl-2-lyso-phosphatidate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- molecular-weight:
- 434.509