Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...") |
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
||
| (4 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-1-LYSOPHOSPHATIDATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wrgqswvcfniunz-gdckjwnlsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 434.509 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15043]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15045]] |
| + | * [[RXN-15068]] | ||
| + | * [[RXN-15091]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleyl-2-lyso-phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=434.509}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleyl-2-lyso-phosphatidate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- molecular-weight:
- 434.509
