Difference between revisions of "L-1-LYSOPHOSPHATIDATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-hemoproteins == * common-name: ** a reduced hemoprotein == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-hemoproteins ==
+
== Metabolite CPD-17403 ==
 
* common-name:
 
* common-name:
** a reduced hemoprotein
+
** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
 +
* smiles:
 +
** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** gccbkkqiemqvgw-pkayedjnsa-j
 +
* molecular-weight:
 +
** 1067.974
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
+
* [[RXN-16155]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced hemoprotein}}
+
{{#set: common-name=(2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa}}
 +
{{#set: inchi-key=inchikey=gccbkkqiemqvgw-pkayedjnsa-j}}
 +
{{#set: molecular-weight=1067.974}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-17403

  • common-name:
    • (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • gccbkkqiemqvgw-pkayedjnsa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality