Difference between revisions of "L-1-PHOSPHATIDYL-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...")
(Created page with "Category:metabolite == Metabolite CPD-17624 == * common-name: ** ω-carboxy-(9z)-octadec-9-enoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DETHIOBIOTIN ==
+
== Metabolite CPD-17624 ==
 
* common-name:
 
* common-name:
** dethiobiotin
+
** ω-carboxy-(9z)-octadec-9-enoyl-coa
 
* smiles:
 
* smiles:
** cc1(nc(=o)nc1cccccc(=o)[o-])
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** autolbmxddtrrt-uhfffaoysa-m
+
** iiswkvfhqlaomw-btfuzuoasa-i
 
* molecular-weight:
 
* molecular-weight:
** 213.256
+
** 1056.928
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
 
* [[RXN-17472]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DETHIOBIOTIN-SYN-RXN]]
+
* [[RXN-16418]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dethiobiotin}}
+
{{#set: common-name=ω-carboxy-(9z)-octadec-9-enoyl-coa}}
{{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=iiswkvfhqlaomw-btfuzuoasa-i}}
{{#set: molecular-weight=213.256}}
+
{{#set: molecular-weight=1056.928}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-17624

  • common-name:
    • ω-carboxy-(9z)-octadec-9-enoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • iiswkvfhqlaomw-btfuzuoasa-i
  • molecular-weight:
    • 1056.928

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality