Difference between revisions of "L-1-PHOSPHATIDYL-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17624 == * common-name: ** ω-carboxy-(9z)-octadec-9-enoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == * common-name: ** an l-1-phosphatidylethanolamine == Reaction(s) known to consume the compound == * 2....")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17624 ==
+
== Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE ==
 
* common-name:
 
* common-name:
** ω-carboxy-(9z)-octadec-9-enoyl-coa
+
** an l-1-phosphatidylethanolamine
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** iiswkvfhqlaomw-btfuzuoasa-i
 
* molecular-weight:
 
** 1056.928
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.17-RXN]]
 +
* [[RXN-1382]]
 +
* [[RXN0-6725]]
 +
* [[RXN0-6952]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16418]]
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[RXN-1382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ω-carboxy-(9z)-octadec-9-enoyl-coa}}
+
{{#set: common-name=an l-1-phosphatidylethanolamine}}
{{#set: inchi-key=inchikey=iiswkvfhqlaomw-btfuzuoasa-i}}
 
{{#set: molecular-weight=1056.928}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE

  • common-name:
    • an l-1-phosphatidylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality