Difference between revisions of "L-1-PHOSPHATIDYL-ETHANOLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...") |
(Created page with "Category:metabolite == Metabolite D-Gal-NAc--Glycoproteins == * common-name: ** an n-acetyl-α-d-galactosalaminyl-[glycoprotein] == Reaction(s) known to consume the c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-Gal-NAc--Glycoproteins == |
* common-name: | * common-name: | ||
− | ** | + | ** an n-acetyl-α-d-galactosalaminyl-[glycoprotein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[2. | + | * [[2.4.1.122-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-α-d-galactosalaminyl-[glycoprotein]}} |
− | |||
− |
Revision as of 15:24, 5 January 2021
Contents
Metabolite D-Gal-NAc--Glycoproteins
- common-name:
- an n-acetyl-α-d-galactosalaminyl-[glycoprotein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-α-d-galactosalaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.