Difference between revisions of "L-1-PHOSPHATIDYL-GLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL == * common-name: ** an l-1-phosphatidyl-sn-glycerol == Reaction(s) known to consume the compound == * CARDIO...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-609 ==
+
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** an l-1-phosphatidyl-sn-glycerol
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
 
* inchi-key:
 
** olgwxcqxrssqpo-mharetsrsa-j
 
* molecular-weight:
 
** 864.359
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.17-RXN]]
+
* [[CARDIOLIPSYN-RXN]]
 +
* [[RXN-8141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PGPPHOSPHA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
{{#set: common-name=an l-1-phosphatidyl-sn-glycerol}}
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
 
{{#set: molecular-weight=864.359}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite L-1-PHOSPHATIDYL-GLYCEROL

  • common-name:
    • an l-1-phosphatidyl-sn-glycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality