Difference between revisions of "L-1-PHOSPHATIDYL-GLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...")
(Created page with "Category:metabolite == Metabolite CPD-17275 == * common-name: ** 7-oxolithocholate * smiles: ** cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))))ccc(=o)[o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-609 ==
+
== Metabolite CPD-17275 ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** 7-oxolithocholate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
+
** cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))))ccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** olgwxcqxrssqpo-mharetsrsa-j
+
** dxocdbgwdzayrq-aurdafmxsa-m
 
* molecular-weight:
 
* molecular-weight:
** 864.359
+
** 389.554
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.17-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16033]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
{{#set: common-name=7-oxolithocholate}}
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
+
{{#set: inchi-key=inchikey=dxocdbgwdzayrq-aurdafmxsa-m}}
{{#set: molecular-weight=864.359}}
+
{{#set: molecular-weight=389.554}}

Revision as of 15:31, 5 January 2021

Metabolite CPD-17275

  • common-name:
    • 7-oxolithocholate
  • smiles:
    • cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))))ccc(=o)[o-]
  • inchi-key:
    • dxocdbgwdzayrq-aurdafmxsa-m
  • molecular-weight:
    • 389.554

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality