Difference between revisions of "L-1-PHOSPHATIDYL-GLYCEROL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * smiles:...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P == * common-name: ** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate == Reaction(s) known to consume the compou...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C1 ==
+
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate
* smiles:
 
** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o)
 
* inchi-key:
 
** imwoxezvyqdrdf-mczxnmlpsa-j
 
* molecular-weight:
 
** 1189.924
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[PGPPHOSPHA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHOSPHAGLYPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}}
 
{{#set: molecular-weight=1189.924}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P

  • common-name:
    • 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality