Difference between revisions of "L-1-phosphatidyl-inositols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-15972 == * common-name: ** lactose == Reaction(s) known to consume the compound == * BETAGALACTOSID-RXN == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15972 == |
* common-name: | * common-name: | ||
| − | ** | + | ** lactose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BETAGALACTOSID-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LACTOSE-SYNTHASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=lactose}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-15972
- common-name:
- lactose
