Difference between revisions of "L-2-hydroxyacids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
(Created page with "Category:metabolite == Metabolite N-terminal-XPK == * common-name: ** an n-terminal-(a/s)pk-[protein] == Reaction(s) known to consume the compound == * RXN-12889 * R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-terminal-XPK == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-(a/s)pk-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12889]] | ||
| + | * [[RXN-13225]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-(a/s)pk-[protein]}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite N-terminal-XPK
- common-name:
- an n-terminal-(a/s)pk-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-(a/s)pk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
