Difference between revisions of "L-ALLO-THREONINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE == * common-name: ** n-succinyl-2-amino-6-ketopimelate * smiles: ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o...")
(Created page with "Category:metabolite == Metabolite L-ALLO-THREONINE == * common-name: ** l-allo-threonine * smiles: ** cc(o)c([n+])c(=o)[o-] * inchi-key: ** ayfvyjqapqtccc-hrfvkafmsa-n * m...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE ==
+
== Metabolite L-ALLO-THREONINE ==
 
* common-name:
 
* common-name:
** n-succinyl-2-amino-6-ketopimelate
+
** l-allo-threonine
 
* smiles:
 
* smiles:
** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
+
** cc(o)c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** sdvxscsnvvzwdd-lurjtmiesa-k
+
** ayfvyjqapqtccc-hrfvkafmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 286.218
+
** 119.12
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+
* [[LTAA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-succinyl-2-amino-6-ketopimelate}}
+
{{#set: common-name=l-allo-threonine}}
{{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}}
+
{{#set: inchi-key=inchikey=ayfvyjqapqtccc-hrfvkafmsa-n}}
{{#set: molecular-weight=286.218}}
+
{{#set: molecular-weight=119.12}}

Latest revision as of 11:14, 18 March 2021

Metabolite L-ALLO-THREONINE

  • common-name:
    • l-allo-threonine
  • smiles:
    • cc(o)c([n+])c(=o)[o-]
  • inchi-key:
    • ayfvyjqapqtccc-hrfvkafmsa-n
  • molecular-weight:
    • 119.12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality