Difference between revisions of "L-ALPHA-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...")
(Created page with "Category:metabolite == Metabolite L-ALPHA-ALANINE == * common-name: ** l-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key: ** qnaybmklocpygj-reohclbhsa-n * molecular-wei...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11281 ==
+
== Metabolite L-ALPHA-ALANINE ==
 
* common-name:
 
* common-name:
−
** s-sulfanylglutathione
+
** l-alanine
 
* smiles:
 
* smiles:
−
** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** qbolvlbsugjhgb-wdskdsinsa-m
+
** qnaybmklocpygj-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 338.373
+
** 89.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[FESGSHTHIO-RXN]]
+
* [[7KAPSYN-RXN]]
−
* [[RXN-13161]]
+
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE-DEHYDROGENASE-RXN]]
 +
* [[RXN-13698]]
 +
* [[RXN-9787]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[3.4.11.2-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE-DEHYDROGENASE-RXN]]
 +
* [[RXN-12588]]
 +
* [[RXN-13698]]
 +
* [[RXN-14385]]
 +
* [[RXN-15881]]
 +
* [[RXN-8351]]
 +
* [[RXN-9787]]
 +
* [[RXN0-308]]
 +
* [[RXN0-6975]]
 +
* [[RXN0-6976]]
 +
* [[RXN0-6977]]
 +
* [[RXN0-6978]]
 +
* [[RXN0-6979]]
 +
* [[RXN0-6980]]
 +
* [[RXN0-6981]]
 +
* [[RXN0-6985]]
 +
* [[SELENOCYSTEINE-LYASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=s-sulfanylglutathione}}
+
{{#set: common-name=l-alanine}}
−
{{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=qnaybmklocpygj-reohclbhsa-n}}
−
{{#set: molecular-weight=338.373}}
+
{{#set: molecular-weight=89.094}}

Latest revision as of 11:13, 18 March 2021

Metabolite L-ALPHA-ALANINE

  • common-name:
    • l-alanine
  • smiles:
    • cc([n+])c([o-])=o
  • inchi-key:
    • qnaybmklocpygj-reohclbhsa-n
  • molecular-weight:
    • 89.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ALPHA-ALANINE&oldid=137702"