Difference between revisions of "L-ALPHA-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03481 == * transcription-direction: ** positive * right-end-position: ** 95202 * left-end-position: ** 84894 * centisome-position: ** 16.195797...")
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03481 ==
+
== Metabolite CPD-11281 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** s-sulfanylglutathione
−
* right-end-position:
+
* smiles:
−
** 95202
+
** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 84894
+
** qbolvlbsugjhgb-wdskdsinsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 16.195797   
+
** 338.373
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[FESGSHTHIO-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-13161]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[3.1.1.23-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=s-sulfanylglutathione}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}}
−
* [[3.1.1.64-RXN]]
+
{{#set: molecular-weight=338.373}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[CARBOXYLESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10711]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10767]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12252]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12575]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15088]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15089]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[LIPAS-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7420]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=95202}}
 
−
{{#set: left-end-position=84894}}
 
−
{{#set: centisome-position=16.195797    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=11}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-11281

  • common-name:
    • s-sulfanylglutathione
  • smiles:
    • c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • qbolvlbsugjhgb-wdskdsinsa-m
  • molecular-weight:
    • 338.373

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ALPHA-ALANINE&oldid=46517"