Difference between revisions of "L-ALPHA-ALANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7598 == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco * inchi-key: ** lgeqqwmqcriykg-dofzraljsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common-name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * inchi-key: ** xzeuytksayn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12850 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol |
| − | |||
| − | |||
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzeuytksaynypk-wxpwfurysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 412.698 |
| + | * smiles: | ||
| + | ** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5)))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN11876]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-21831]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzeuytksaynypk-wxpwfurysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-12850
- common-name:
- 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
- inchi-key:
- xzeuytksaynypk-wxpwfurysa-n
- molecular-weight:
- 412.698
- smiles:
- cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))
