Difference between revisions of "L-ALPHA-AMINO-EPSILON-KETO-PIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8091 == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop...")
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-8091 ==
+
== Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE ==
 
* common-name:
 
* common-name:
−
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
+
** l-α-amino-ε-keto-pimelate
 
* smiles:
 
* smiles:
−
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
 
* inchi-key:
 
* inchi-key:
−
** gdwulugdxghjij-vjhnmzkjsa-n
+
** ukcsfklwnhubdy-bypyzucnsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 784.107
+
** 188.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8322]]
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
−
* [[RXN-8326]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8327]]
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=l-α-amino-ε-keto-pimelate}}
−
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
+
{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
−
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=188.16}}

Latest revision as of 11:14, 18 March 2021

Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE

  • common-name:
    • l-α-amino-ε-keto-pimelate
  • smiles:
    • c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
  • inchi-key:
    • ukcsfklwnhubdy-bypyzucnsa-m
  • molecular-weight:
    • 188.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE&oldid=138239"