Difference between revisions of "L-ARGININO-SUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42. ACECOATRANS-RXN-CPD-10280/ACET//TETRA...") |
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-ARGININO-SUCCINATE == |
| − | * | + | * common-name: |
| − | ** | + | ** l-arginino-succinate |
| − | + | * smiles: | |
| − | * | + | ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] |
| − | == | + | * inchi-key: |
| − | == | + | ** kdzoasgqnopscu-zbhicjrosa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 289.267 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | * [[ARGSUCCINLYA-RXN]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ARGSUCCINLYA-RXN]] | |
| − | {{#set: | + | * [[ARGSUCCINSYN-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=l-arginino-succinate}} | |
| − | + | {{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}} | |
| + | {{#set: molecular-weight=289.267}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-ARGININO-SUCCINATE
- common-name:
- l-arginino-succinate
- smiles:
- c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
- inchi-key:
- kdzoasgqnopscu-zbhicjrosa-m
- molecular-weight:
- 289.267
