Difference between revisions of "L-ARGININO-SUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GALACTOSYLCERAMIDE-SULFATE ==
+
== Metabolite L-ARGININO-SUCCINATE ==
 
* common-name:
 
* common-name:
** a sulfatide
+
** l-arginino-succinate
 +
* smiles:
 +
** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
 +
* inchi-key:
 +
** kdzoasgqnopscu-zbhicjrosa-m
 +
* molecular-weight:
 +
** 289.267
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ARGSUCCINLYA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
* [[ARGSUCCINLYA-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sulfatide}}
+
{{#set: common-name=l-arginino-succinate}}
 +
{{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}}
 +
{{#set: molecular-weight=289.267}}

Latest revision as of 11:16, 18 March 2021

Metabolite L-ARGININO-SUCCINATE

  • common-name:
    • l-arginino-succinate
  • smiles:
    • c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
  • inchi-key:
    • kdzoasgqnopscu-zbhicjrosa-m
  • molecular-weight:
    • 289.267

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality