Difference between revisions of "L-ARGININO-SUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-ARGININO-SUCCINATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-arginino-succinate |
+ | * smiles: | ||
+ | ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] | ||
+ | * inchi-key: | ||
+ | ** kdzoasgqnopscu-zbhicjrosa-m | ||
+ | * molecular-weight: | ||
+ | ** 289.267 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ARGSUCCINLYA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ARGSUCCINLYA-RXN]] |
+ | * [[ARGSUCCINSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-arginino-succinate}} |
+ | {{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}} | ||
+ | {{#set: molecular-weight=289.267}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-ARGININO-SUCCINATE
- common-name:
- l-arginino-succinate
- smiles:
- c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
- inchi-key:
- kdzoasgqnopscu-zbhicjrosa-m
- molecular-weight:
- 289.267