Difference between revisions of "L-ASPARTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13292 == * transcription-direction: ** negative * right-end-position: ** 54819 * left-end-position: ** 24231 * centisome-position: ** 7.063875...")
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13292 ==
+
== Metabolite L-ASPARTATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-aspartate
−
* right-end-position:
+
* smiles:
−
** 54819
+
** c(c(=o)[o-])c([n+])c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 24231
+
** ckljmwtzizzhcs-reohclbhsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 7.063875   
+
** 132.096
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
−
== Reaction(s) associated ==
+
* [[ARGSUCCINSYN-RXN]]
−
* [[3.1.3.16-RXN]]
+
* [[ASNSYNA-RXN]]
−
** Category: [[annotation]]
+
* [[ASNSYNB-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ASPAMINOTRANS-RXN]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
−
** Category: [[annotation]]
+
* [[ASPARTATEKIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ASPCARBTRANS-RXN]]
−
** Category: [[orthology]]
+
* [[L-ASPARTATE-OXID-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
−
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
+
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13697]]
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+
* [[RXN-9772]]
−
** Category: [[annotation]]
+
* [[SAICARSYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[biomass_rxn]]
−
* [[RXN-10958]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[3.4.11.21-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[3.5.1.26-RXN]]
−
== Pathway(s) associated ==
+
* [[ASPAMINOTRANS-RXN]]
−
* [[PWY-6368]]
+
* [[ASPARAGHYD-RXN]]
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[ASPARTATEKIN-RXN]]
−
* [[PWY-6580]]
+
* [[ASPCARBTRANS-RXN]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
−
* [[PWY-6367]]
+
* [[RXN-13697]]
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN0-6975]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN0-6987]]
−
{{#set: right-end-position=54819}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: left-end-position=24231}}
+
{{#set: common-name=l-aspartate}}
−
{{#set: centisome-position=7.063875    }}
+
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=132.096}}
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite L-ASPARTATE

  • common-name:
    • l-aspartate
  • smiles:
    • c(c(=o)[o-])c([n+])c(=o)[o-]
  • inchi-key:
    • ckljmwtzizzhcs-reohclbhsa-m
  • molecular-weight:
    • 132.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ASPARTATE&oldid=137327"