Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12932 == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite L-ASPARTATE-SEMIALDEHYDE == * common-name: ** l-aspartate-semialdehyde * smiles: ** [ch](=o)cc([n+])c(=o)[o-] * inchi-key: ** hoswpdpvfbc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12932 ==
+
== Metabolite L-ASPARTATE-SEMIALDEHYDE ==
 
* common-name:
 
* common-name:
** all-trans-3,4-didehydrolycopene
+
** l-aspartate-semialdehyde
 
* smiles:
 
* smiles:
** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
+
** [ch](=o)cc([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ocmsupsdvxkdfy-fqmrbfjqsa-n
+
** hoswpdpvfbclsy-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 534.867
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11976]]
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
* [[RXN-11999]]
+
* [[DIHYDRODIPICSYN-RXN]]
 +
* [[HOMOSERDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12413]]
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-3,4-didehydrolycopene}}
+
{{#set: common-name=l-aspartate-semialdehyde}}
{{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}}
+
{{#set: inchi-key=inchikey=hoswpdpvfbclsy-vkhmyheasa-n}}
{{#set: molecular-weight=534.867}}
+
{{#set: molecular-weight=117.104}}

Latest revision as of 11:15, 18 March 2021

Metabolite L-ASPARTATE-SEMIALDEHYDE

  • common-name:
    • l-aspartate-semialdehyde
  • smiles:
    • [ch](=o)cc([n+])c(=o)[o-]
  • inchi-key:
    • hoswpdpvfbclsy-vkhmyheasa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality