Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...") |
(Created page with "Category:metabolite == Metabolite METHYLAMINE == * common-name: ** methylamine * smiles: ** c[n+] * inchi-key: ** bavyzaluxzfzlv-uhfffaoysa-o * molecular-weight: ** 32.065...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite METHYLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** methylamine |
* smiles: | * smiles: | ||
| − | ** c | + | ** c[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bavyzaluxzfzlv-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 32.065 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10908]] | ||
| + | * [[RXN-10913]] | ||
| + | * [[RXN-8673]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methylamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bavyzaluxzfzlv-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=32.065}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite METHYLAMINE
- common-name:
- methylamine
- smiles:
- c[n+]
- inchi-key:
- bavyzaluxzfzlv-uhfffaoysa-o
- molecular-weight:
- 32.065
