Difference between revisions of "L-BETA-ASPARTYL-P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-NA+ TransportSeed-NA+] == * direction: ** left-to-right == Reaction formula == * 1.0...") |
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * smiles: ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] * inchi-key: ** ixznk...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-BETA-ASPARTYL-P == |
| − | * | + | * common-name: |
| − | ** | + | ** l-aspartyl-4-phosphate |
| − | + | * smiles: | |
| − | * | + | ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] |
| − | == | + | * inchi-key: |
| − | == | + | ** ixznktpiykdigg-reohclbhsa-l |
| − | + | * molecular-weight: | |
| − | * | + | ** 211.068 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] |
| − | {{#set: | + | * [[ASPARTATEKIN-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] |
| − | + | * [[ASPARTATEKIN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=l-aspartyl-4-phosphate}} | |
| + | {{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}} | ||
| + | {{#set: molecular-weight=211.068}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite L-BETA-ASPARTYL-P
- common-name:
- l-aspartyl-4-phosphate
- smiles:
- c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
- inchi-key:
- ixznktpiykdigg-reohclbhsa-l
- molecular-weight:
- 211.068
