Difference between revisions of "L-BETA-ASPARTYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite pppGp-his-tRNAs == * common-name: ** 5'-triphospho-guanosine-ribonucleotide-[trnahis] == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * smiles: ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] * inchi-key: ** ixznk...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-BETA-ASPARTYL-P == |
* common-name: | * common-name: | ||
− | ** | + | ** l-aspartyl-4-phosphate |
+ | * smiles: | ||
+ | ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** ixznktpiykdigg-reohclbhsa-l | ||
+ | * molecular-weight: | ||
+ | ** 211.068 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
+ | * [[ASPARTATEKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] |
− | * [[RXN | + | * [[ASPARTATEKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-aspartyl-4-phosphate}} |
+ | {{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}} | ||
+ | {{#set: molecular-weight=211.068}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite L-BETA-ASPARTYL-P
- common-name:
- l-aspartyl-4-phosphate
- smiles:
- c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
- inchi-key:
- ixznktpiykdigg-reohclbhsa-l
- molecular-weight:
- 211.068