Difference between revisions of "L-CANALINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13174 == * common-name: ** salicyl-6-hydroxy-2-cyclohexene-on-oyl * smiles: ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite L-CANALINE == * common-name: ** l-canaline * smiles: ** c(cc([n+])c(=o)[o-])on * inchi-key: ** fqpgmqabjnqllf-vkhmyheasa-n * molecular-we...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-CANALINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-canaline |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(cc([n+])c(=o)[o-])on |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fqpgmqabjnqllf-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 134.135 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-34]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-canaline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fqpgmqabjnqllf-vkhmyheasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=134.135}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-CANALINE
- common-name:
- l-canaline
- smiles:
- c(cc([n+])c(=o)[o-])on
- inchi-key:
- fqpgmqabjnqllf-vkhmyheasa-n
- molecular-weight:
- 134.135
