Difference between revisions of "L-CITRULLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite CPD-4702 == * common-name: ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-4 ==
+
== Metabolite CPD-4702 ==
 
* common-name:
 
* common-name:
** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** mfdugtooxgorrx-orglzdqcsa-n
+
** jhiwifrqjxlneu-gsqagghasa-m
 
* molecular-weight:
 
* molecular-weight:
** 382.542
+
** 427.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-318]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[RXN-13709]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
{{#set: common-name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}}
+
{{#set: inchi-key=inchikey=jhiwifrqjxlneu-gsqagghasa-m}}
{{#set: molecular-weight=382.542}}
+
{{#set: molecular-weight=427.646}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-4702

  • common-name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • jhiwifrqjxlneu-gsqagghasa-m
  • molecular-weight:
    • 427.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality