Difference between revisions of "L-CITRULLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL == * common-name: ** an l-1-phosphatidyl-sn-glycerol == Reaction(s) known to consume the compound == * CARDIO...")
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL ==
+
== Metabolite L-CITRULLINE ==
 
* common-name:
 
* common-name:
** an l-1-phosphatidyl-sn-glycerol
+
** l-citrulline
 +
* smiles:
 +
** c(nc(n)=o)ccc([n+])c(=o)[o-]
 +
* inchi-key:
 +
** rhgklrlohdjjdr-bypyzucnsa-n
 +
* molecular-weight:
 +
** 175.187
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARDIOLIPSYN-RXN]]
+
* [[ARGSUCCINSYN-RXN]]
* [[RXN-8141]]
+
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PGPPHOSPHA-RXN]]
+
* [[DIMETHYLARGININASE-RXN]]
 +
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[RXN-13482]]
 +
* [[RXN-13565]]
 +
* [[RXN-7933]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-1-phosphatidyl-sn-glycerol}}
+
{{#set: common-name=l-citrulline}}
 +
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
 +
{{#set: molecular-weight=175.187}}

Latest revision as of 11:18, 18 March 2021

Metabolite L-CITRULLINE

  • common-name:
    • l-citrulline
  • smiles:
    • c(nc(n)=o)ccc([n+])c(=o)[o-]
  • inchi-key:
    • rhgklrlohdjjdr-bypyzucnsa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality