Difference between revisions of "L-CITRULLINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16559 RXN-16559] == * direction: ** reversible * common-name: ** long-chain-3-hydroxyacyl-coa d...") |
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-CITRULLINE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-citrulline |
| − | * | + | * smiles: |
| − | ** | + | ** c(nc(n)=o)ccc([n+])c(=o)[o-] |
| − | == Reaction | + | * inchi-key: |
| − | * | + | ** rhgklrlohdjjdr-bypyzucnsa-n |
| − | == | + | * molecular-weight: |
| − | * | + | ** 175.187 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[ARGSUCCINSYN-RXN]] |
| − | * | + | * [[ORNCARBAMTRANSFER-RXN]] |
| − | * | + | * [[RXN-13482]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[DIMETHYLARGININASE-RXN]] |
| − | + | * [[NITRIC-OXIDE-SYNTHASE-RXN]] | |
| − | + | * [[ORNCARBAMTRANSFER-RXN]] | |
| − | + | * [[RXN-13482]] | |
| − | + | * [[RXN-13565]] | |
| − | + | * [[RXN-7933]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: common-name= | + | {{#set: common-name=l-citrulline}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=175.187}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite L-CITRULLINE
- common-name:
- l-citrulline
- smiles:
- c(nc(n)=o)ccc([n+])c(=o)[o-]
- inchi-key:
- rhgklrlohdjjdr-bypyzucnsa-n
- molecular-weight:
- 175.187
