Difference between revisions of "L-CITRULLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * molecular-weight: *...")
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE ==
+
== Metabolite L-CITRULLINE ==
 
* common-name:
 
* common-name:
** indole
+
** l-citrulline
 
* smiles:
 
* smiles:
** c2(c=cc1(=c(c=cn1)c=2))
+
** c(nc(n)=o)ccc([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** sikjaqjrhwyjai-uhfffaoysa-n
+
** rhgklrlohdjjdr-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 117.15
+
** 175.187
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INDOLE-23-DIOXYGENASE-RXN]]
+
* [[ARGSUCCINSYN-RXN]]
* [[RXN0-2381]]
+
* [[ORNCARBAMTRANSFER-RXN]]
* [[RXN0-2382]]
+
* [[RXN-13482]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2381]]
+
* [[DIMETHYLARGININASE-RXN]]
 +
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[RXN-13482]]
 +
* [[RXN-13565]]
 +
* [[RXN-7933]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole}}
+
{{#set: common-name=l-citrulline}}
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
{{#set: molecular-weight=117.15}}
+
{{#set: molecular-weight=175.187}}

Latest revision as of 11:18, 18 March 2021

Metabolite L-CITRULLINE

  • common-name:
    • l-citrulline
  • smiles:
    • c(nc(n)=o)ccc([n+])c(=o)[o-]
  • inchi-key:
    • rhgklrlohdjjdr-bypyzucnsa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality