Difference between revisions of "L-CITRULLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * molecular-weight: *...") |
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-4 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mfdugtooxgorrx-orglzdqcsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 382.542 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-698]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=382.542}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD1F-4
- common-name:
- (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- smiles:
- cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
- inchi-key:
- mfdugtooxgorrx-orglzdqcsa-n
- molecular-weight:
- 382.542