Difference between revisions of "L-CYSTATHIONINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Methyl-thioethers == * common-name: ** a methyl thioether == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o * inchi-key: ** ilrylpwnyfxemh-w...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-CYSTATHIONINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-cystathionine |
| + | * smiles: | ||
| + | ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** ilrylpwnyfxemh-whfbiakzsa-n | ||
| + | * molecular-weight: | ||
| + | ** 222.259 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CYSTATHIONASE-RXN]] | ||
| + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
| + | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
| + | * [[RXN-14048]] | ||
| + | * [[RXN-15130]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CYSPH-RXN]] |
| + | * [[CYSTATHIONASE-RXN]] | ||
| + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
| + | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-cystathionine}} |
| + | {{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}} | ||
| + | {{#set: molecular-weight=222.259}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-CYSTATHIONINE
- common-name:
- l-cystathionine
- smiles:
- c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
- inchi-key:
- ilrylpwnyfxemh-whfbiakzsa-n
- molecular-weight:
- 222.259
