Difference between revisions of "L-CYSTATHIONINE"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17271 ==
+== Metabolite L-CYSTATHIONINE ==
 * common-name:
-** 1-stearoyl-2-palmitoyl-glycerol
+** l-cystathionine
 * smiles:
-** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 * inchi-key:
-** vyqdalbeqrzdpl-dhujradrsa-n
+** ilrylpwnyfxemh-whfbiakzsa-n
 * molecular-weight:
-** 596.973
+** 222.259
 == Reaction(s) known to consume the compound ==
-* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+* [[CYSTATHIONASE-RXN]]
-* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
-* [[RXN-16030]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
+* [[RXN-14048]]
+* [[RXN-15130]]
 == Reaction(s) known to produce the compound ==
-* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+* [[CYSPH-RXN]]
-* [[RXN-16030]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-stearoyl-2-palmitoyl-glycerol}}
+{{#set: common-name=l-cystathionine}}
-{{#set: inchi-key=inchikey=vyqdalbeqrzdpl-dhujradrsa-n}}
+{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
-{{#set: molecular-weight=596.973}}
+{{#set: molecular-weight=222.259}}