Difference between revisions of "L-CYSTATHIONINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00782 == * transcription-direction: ** positive * right-end-position: ** 123059 * left-end-position: ** 111206 * centisome-position: ** 68.86332...") |
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o * inchi-key: ** ilrylpwnyfxemh-w...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-CYSTATHIONINE == |
− | * | + | * common-name: |
− | ** | + | ** l-cystathionine |
− | * | + | * smiles: |
− | ** | + | ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** ilrylpwnyfxemh-whfbiakzsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 222.259 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[CYSTATHIONASE-RXN]] |
− | + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | |
− | * [[ | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
− | * | + | * [[RXN-14048]] |
− | * | + | * [[RXN-15130]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[CYSPH-RXN]] |
− | {{#set: | + | * [[CYSTATHIONASE-RXN]] |
− | {{#set: | + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] |
− | + | * [[O-SUCCHOMOSERLYASE-RXN]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-cystathionine}} | |
− | + | {{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}} | |
+ | {{#set: molecular-weight=222.259}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-CYSTATHIONINE
- common-name:
- l-cystathionine
- smiles:
- c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
- inchi-key:
- ilrylpwnyfxemh-whfbiakzsa-n
- molecular-weight:
- 222.259