Difference between revisions of "L-CYSTATHIONINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o * inchi-key: ** ilrylpwnyfxemh-w...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14916 ==
+
== Metabolite L-CYSTATHIONINE ==
 
* common-name:
 
* common-name:
** (r)-3-hydroxyoctanoyl-coa
+
** l-cystathionine
 
* smiles:
 
* smiles:
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** atvgtmkwkducms-jwbywsjjsa-j
+
** ilrylpwnyfxemh-whfbiakzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 905.7
+
** 222.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[CYSTATHIONASE-RXN]]
* [[RXN-14275]]
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-14048]]
 +
* [[RXN-15130]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[CYSPH-RXN]]
* [[RXN-14276]]
+
* [[CYSTATHIONASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
+
{{#set: common-name=l-cystathionine}}
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
+
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
{{#set: molecular-weight=905.7}}
+
{{#set: molecular-weight=222.259}}

Latest revision as of 11:13, 18 March 2021

Metabolite L-CYSTATHIONINE

  • common-name:
    • l-cystathionine
  • smiles:
    • c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
  • inchi-key:
    • ilrylpwnyfxemh-whfbiakzsa-n
  • molecular-weight:
    • 222.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality