Difference between revisions of "L-CYSTATHIONINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06565 == * transcription-direction: ** negative * right-end-position: ** 432509 * left-end-position: ** 398048 * centisome-position: ** 84.15053...")
(Created page with "Category:metabolite == Metabolite CPD-14916 == * common-name: ** (r)-3-hydroxyoctanoyl-coa * smiles: ** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06565 ==
+
== Metabolite CPD-14916 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (r)-3-hydroxyoctanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 432509
+
** cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
−
* left-end-position:
+
* inchi-key:
−
** 398048
+
** atvgtmkwkducms-jwbywsjjsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 84.15053   
+
** 905.7
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
−
== Reaction(s) associated ==
+
* [[RXN-14275]]
−
* [[GLY3KIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14276]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(r)-3-hydroxyoctanoyl-coa}}
−
* [[URIDINEKIN-RXN]]
+
{{#set: inchi-key=inchikey=atvgtmkwkducms-jwbywsjjsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=905.7}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[URKI-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-181]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7193]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=432509}}
 
−
{{#set: left-end-position=398048}}
 
−
{{#set: centisome-position=84.15053    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-14916

  • common-name:
    • (r)-3-hydroxyoctanoyl-coa
  • smiles:
    • cccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • atvgtmkwkducms-jwbywsjjsa-j
  • molecular-weight:
    • 905.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-CYSTATHIONINE&oldid=46757"