Difference between revisions of "L-CYSTEATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Phosphatase-2A-leucine == * common-name: ** a [phosphatase 2a protein] c-terminal l-leucine == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite L-CYSTEATE == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] * inchi-key: ** xvoyscvbglvsol-reohclbhsa-m * mo...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Phosphatase-2A-leucine ==
+
== Metabolite L-CYSTEATE ==
 
* common-name:
 
* common-name:
** a [phosphatase 2a protein] c-terminal l-leucine
+
** l-cysteate
 +
* smiles:
 +
** c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
 +
* inchi-key:
 +
** xvoyscvbglvsol-reohclbhsa-m
 +
* molecular-weight:
 +
** 168.144
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11737]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12322]]
+
* [[RXN-11737]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [phosphatase 2a protein] c-terminal l-leucine}}
+
{{#set: common-name=l-cysteate}}
 +
{{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}}
 +
{{#set: molecular-weight=168.144}}

Latest revision as of 11:15, 18 March 2021

Metabolite L-CYSTEATE

  • common-name:
    • l-cysteate
  • smiles:
    • c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
  • inchi-key:
    • xvoyscvbglvsol-reohclbhsa-m
  • molecular-weight:
    • 168.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality