Difference between revisions of "L-CYSTEATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phosphatase-2A-leucine == * common-name: ** a [phosphatase 2a protein] c-terminal l-leucine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite L-CYSTEATE == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] * inchi-key: ** xvoyscvbglvsol-reohclbhsa-m * mo...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-CYSTEATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-cysteate |
+ | * smiles: | ||
+ | ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** xvoyscvbglvsol-reohclbhsa-m | ||
+ | * molecular-weight: | ||
+ | ** 168.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-11737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11737]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-cysteate}} |
+ | {{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}} | ||
+ | {{#set: molecular-weight=168.144}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite L-CYSTEATE
- common-name:
- l-cysteate
- smiles:
- c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
- inchi-key:
- xvoyscvbglvsol-reohclbhsa-m
- molecular-weight:
- 168.144