Difference between revisions of "L-CYSTEATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14964 RXN-14964] == * direction: ** left-to-right * common-name: ** glycerol-1-phosphatase * ec...") |
(Created page with "Category:metabolite == Metabolite L-CYSTEATE == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] * inchi-key: ** xvoyscvbglvsol-reohclbhsa-m * mo...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-CYSTEATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-cysteate |
| − | * | + | * smiles: |
| − | ** [ | + | ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] |
| − | + | * inchi-key: | |
| − | + | ** xvoyscvbglvsol-reohclbhsa-m | |
| − | == | + | * molecular-weight: |
| − | + | ** 168.144 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | *** | + | * [[RXN-11737]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-11737]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=l-cysteate}} |
| − | * | + | {{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}} |
| − | + | {{#set: molecular-weight=168.144}} | |
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite L-CYSTEATE
- common-name:
- l-cysteate
- smiles:
- c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
- inchi-key:
- xvoyscvbglvsol-reohclbhsa-m
- molecular-weight:
- 168.144
