Difference between revisions of "L-CYSTEATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HX == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
(Created page with "Category:metabolite == Metabolite L-CYSTEATE == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] * inchi-key: ** xvoyscvbglvsol-reohclbhsa-m * mo...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HX ==
+
== Metabolite L-CYSTEATE ==
 +
* common-name:
 +
** l-cysteate
 
* smiles:
 
* smiles:
** [xh]
+
** c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
* common-name:
+
* inchi-key:
** hx
+
** xvoyscvbglvsol-reohclbhsa-m
 +
* molecular-weight:
 +
** 168.144
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11737]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GSHTRAN-RXN]]
+
* [[RXN-11737]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hx}}
+
{{#set: common-name=l-cysteate}}
 +
{{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}}
 +
{{#set: molecular-weight=168.144}}

Latest revision as of 11:15, 18 March 2021

Metabolite L-CYSTEATE

  • common-name:
    • l-cysteate
  • smiles:
    • c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
  • inchi-key:
    • xvoyscvbglvsol-reohclbhsa-m
  • molecular-weight:
    • 168.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality