Difference between revisions of "L-CYSTEATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: ** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-] * inchi-k...")
(Created page with "Category:metabolite == Metabolite HX == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15036 ==
+
== Metabolite HX ==
 +
* smiles:
 +
** [xh]
 
* common-name:
 
* common-name:
** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
+
** hx
* smiles:
 
** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
 
* inchi-key:
 
** wfkzeqzrfipkif-ucorvyfpsa-l
 
* molecular-weight:
 
** 254.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14021]]
+
* [[GSHTRAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate}}
+
{{#set: common-name=hx}}
{{#set: inchi-key=inchikey=wfkzeqzrfipkif-ucorvyfpsa-l}}
 
{{#set: molecular-weight=254.168}}
 

Revision as of 14:58, 5 January 2021

Metabolite HX

  • smiles:
    • [xh]
  • common-name:
    • hx

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality