Difference between revisions of "L-CYSTEATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...") |
(Created page with "Category:metabolite == Metabolite Phosphatase-2A-leucine == * common-name: ** a [phosphatase 2a protein] c-terminal l-leucine == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Phosphatase-2A-leucine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [phosphatase 2a protein] c-terminal l-leucine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12322]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [phosphatase 2a protein] c-terminal l-leucine}} |
− | |||
− |
Revision as of 11:17, 15 January 2021
Contents
Metabolite Phosphatase-2A-leucine
- common-name:
- a [phosphatase 2a protein] c-terminal l-leucine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [phosphatase 2a protein] c-terminal l-leucine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.