Difference between revisions of "L-Cysteine-Desulfurase-persulfide"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc == * common-name: ** a [heparan]-n-acetyl-α-d-glucosamine == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == * common-name: ** 3-demethylubiquinol-6 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-demethylubiquinol-6 |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** zqxnznkhqxlvcv-hgjbzhbgsa-n | ||
| + | * molecular-weight: | ||
| + | ** 578.874 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN3O-102]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-demethylubiquinol-6}} |
| + | {{#set: inchi-key=inchikey=zqxnznkhqxlvcv-hgjbzhbgsa-n}} | ||
| + | {{#set: molecular-weight=578.874}} | ||
Revision as of 08:30, 15 March 2021
Contents
Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX
- common-name:
- 3-demethylubiquinol-6
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- zqxnznkhqxlvcv-hgjbzhbgsa-n
- molecular-weight:
- 578.874
