Difference between revisions of "L-Cysteine-Desulfurases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9090 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...") |
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MENADIOL == |
| + | * common-name: | ||
| + | ** menadiol | ||
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** zjtlzydqjhkrmq-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menadiol}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}} |
| + | {{#set: molecular-weight=174.199}} | ||
Revision as of 11:13, 15 January 2021
Contents
Metabolite MENADIOL
- common-name:
- menadiol
- smiles:
- cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
- inchi-key:
- zjtlzydqjhkrmq-uhfffaoysa-n
- molecular-weight:
- 174.199
