Difference between revisions of "L-Cysteine-Desulfurases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...")
(Created page with "Category:metabolite == Metabolite CPD0-1133 == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MENADIOL ==
+
== Metabolite CPD0-1133 ==
 
* common-name:
 
* common-name:
** menadiol
+
** maltoheptaose
 
* smiles:
 
* smiles:
** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
 
* inchi-key:
 
* inchi-key:
** zjtlzydqjhkrmq-uhfffaoysa-n
+
** bnabbhgyymzmoa-qjbbzcpbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 174.199
+
** 1153.009
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14283]]
 +
* [[RXN-14286]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menadiol}}
+
{{#set: common-name=maltoheptaose}}
{{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}}
{{#set: molecular-weight=174.199}}
+
{{#set: molecular-weight=1153.009}}

Revision as of 08:24, 15 March 2021

Metabolite CPD0-1133

  • common-name:
    • maltoheptaose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
  • inchi-key:
    • bnabbhgyymzmoa-qjbbzcpbsa-n
  • molecular-weight:
    • 1153.009

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality