Difference between revisions of "L-Cysteine-Desulfurases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3723 == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurases == * common-name: ** an [l-cysteine desulfurase] == Reaction(s) known to consume the compound == * RXN-15881...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-Cysteine-Desulfurases == |
* common-name: | * common-name: | ||
− | ** | + | ** an [l-cysteine desulfurase] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15881]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an [l-cysteine desulfurase]}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-Cysteine-Desulfurases
- common-name:
- an [l-cysteine desulfurase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [l-cysteine desulfurase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.